C9H15F2NO2 — CID 103513928
2,2-difluoro-N-[(2-hydroxycyclohexyl)methyl]acetamide (PubChem CID 103513928) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[(2-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 103513928 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2,2-difluoro-N-[(2-hydroxycyclohexyl)methyl]acetamide |
| SMILES | O=C(NCC1CCCCC1O)C(F)F |
| InChI | InChI=1S/C9H15F2NO2/c10-8(11)9(14)12-5-6-3-1-2-4-7(6)13/h6-8,13H,1-5H2,(H,12,14) |
| InChIKey | DYHAFFAXVVNJKV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |