C11H12ClF2NO — CID 103514772
N-[(2-chlorophenyl)methyl]-N-ethyl-2,2-difluoroacetamide (PubChem CID 103514772) has the molecular formula C11H12ClF2NO and a molecular weight of 247.67 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-ethyl-2,2-difluoroacetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-ethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103514772 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-ethyl-2,2-difluoroacetamide |
| SMILES | CCN(Cc1ccccc1Cl)C(=O)C(F)F |
| InChI | InChI=1S/C11H12ClF2NO/c1-2-15(11(16)10(13)14)7-8-5-3-4-6-9(8)12/h3-6,10H,2,7H2,1H3 |
| InChIKey | CQNQFEBGOXKXFR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |