C9H15F2NO — CID 103515473
2,2-difluoro-N-[(1-methylcyclopentyl)methyl]acetamide (PubChem CID 103515473) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is 2,2-difluoro-N-[(1-methylcyclopentyl)methyl]acetamide.
| Compound Name | 2,2-difluoro-N-[(1-methylcyclopentyl)methyl]acetamide |
|---|---|
| PubChem CID | 103515473 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2,2-difluoro-N-[(1-methylcyclopentyl)methyl]acetamide |
| SMILES | CC1(CNC(=O)C(F)F)CCCC1 |
| InChI | InChI=1S/C9H15F2NO/c1-9(4-2-3-5-9)6-12-8(13)7(10)11/h7H,2-6H2,1H3,(H,12,13) |
| InChIKey | URNGDVBVVUTGJD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |