C8H14F2N2O — CID 164661336
N-[(1-aminocyclopentyl)methyl]-2,2-difluoroacetamide (PubChem CID 164661336) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is N-[(1-aminocyclopentyl)methyl]-2,2-difluoroacetamide.
| Compound Name | N-[(1-aminocyclopentyl)methyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 164661336 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N-[(1-aminocyclopentyl)methyl]-2,2-difluoroacetamide |
| SMILES | NC1(CNC(=O)C(F)F)CCCC1 |
| InChI | InChI=1S/C8H14F2N2O/c9-6(10)7(13)12-5-8(11)3-1-2-4-8/h6H,1-5,11H2,(H,12,13) |
| InChIKey | XDSFXBQNFDGLMA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |