C10H18F2N2O — CID 103515570
2,2-difluoro-N-[2-(4-methylpiperidin-1-yl)ethyl]acetamide (PubChem CID 103515570) has the molecular formula C10H18F2N2O and a molecular weight of 220.26 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(4-methylpiperidin-1-yl)ethyl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-(4-methylpiperidin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103515570 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2,2-difluoro-N-[2-(4-methylpiperidin-1-yl)ethyl]acetamide |
| SMILES | CC1CCN(CCNC(=O)C(F)F)CC1 |
| InChI | InChI=1S/C10H18F2N2O/c1-8-2-5-14(6-3-8)7-4-13-10(15)9(11)12/h8-9H,2-7H2,1H3,(H,13,15) |
| InChIKey | WOUDVUPEDWNBHR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |