C6H8F2N4O — CID 103516019
2,2-difluoro-N-[2-(triazol-1-yl)ethyl]acetamide (PubChem CID 103516019) has the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(triazol-1-yl)ethyl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-(triazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103516019 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2,2-difluoro-N-[2-(triazol-1-yl)ethyl]acetamide |
| SMILES | O=C(NCCn1ccnn1)C(F)F |
| InChI | InChI=1S/C6H8F2N4O/c7-5(8)6(13)9-1-3-12-4-2-10-11-12/h2,4-5H,1,3H2,(H,9,13) |
| InChIKey | NMSHPURLZGBBQV-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |