C7H10F2N4O — CID 103516020
2,2-difluoro-N-[3-(triazol-1-yl)propyl]acetamide (PubChem CID 103516020) has the molecular formula C7H10F2N4O and a molecular weight of 204.18 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-(triazol-1-yl)propyl]acetamide.
| Compound Name | 2,2-difluoro-N-[3-(triazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 103516020 |
| Molecular Formula | C7H10F2N4O |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2,2-difluoro-N-[3-(triazol-1-yl)propyl]acetamide |
| SMILES | O=C(NCCCn1ccnn1)C(F)F |
| InChI | InChI=1S/C7H10F2N4O/c8-6(9)7(14)10-2-1-4-13-5-3-11-12-13/h3,5-6H,1-2,4H2,(H,10,14) |
| InChIKey | OEWPPCVUGQVYQJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|