C8H12F2N4O2 — CID 103769662
N-(3,3-difluoro-2-hydroxypropyl)-3-(triazol-1-yl)propanamide (PubChem CID 103769662) has the molecular formula C8H12F2N4O2 and a molecular weight of 234.21 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-(triazol-1-yl)propanamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-(triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 103769662 |
| Molecular Formula | C8H12F2N4O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-(triazol-1-yl)propanamide |
| SMILES | O=C(CCn1ccnn1)NCC(O)C(F)F |
| InChI | InChI=1S/C8H12F2N4O2/c9-8(10)6(15)5-11-7(16)1-3-14-4-2-12-13-14/h2,4,6,8,15H,1,3,5H2,(H,11,16) |
| InChIKey | BWQMSUWLCLVQPI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |