C8H13F2NOS — CID 103516063
2,2-difluoro-N-(thian-4-ylmethyl)acetamide (PubChem CID 103516063) has the molecular formula C8H13F2NOS and a molecular weight of 209.26 g/mol. Its IUPAC name is 2,2-difluoro-N-(thian-4-ylmethyl)acetamide.
| Compound Name | 2,2-difluoro-N-(thian-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 103516063 |
| Molecular Formula | C8H13F2NOS |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2,2-difluoro-N-(thian-4-ylmethyl)acetamide |
| SMILES | O=C(NCC1CCSCC1)C(F)F |
| InChI | InChI=1S/C8H13F2NOS/c9-7(10)8(12)11-5-6-1-3-13-4-2-6/h6-7H,1-5H2,(H,11,12) |
| InChIKey | JVHDIWLETKZBNO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |