C10H14ClF2NO2 — CID 103516301
N-[1-(3-chloro-2-oxopropyl)cyclopentyl]-2,2-difluoroacetamide (PubChem CID 103516301) has the molecular formula C10H14ClF2NO2 and a molecular weight of 253.68 g/mol. Its IUPAC name is N-[1-(3-chloro-2-oxopropyl)cyclopentyl]-2,2-difluoroacetamide.
| Compound Name | N-[1-(3-chloro-2-oxopropyl)cyclopentyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103516301 |
| Molecular Formula | C10H14ClF2NO2 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[1-(3-chloro-2-oxopropyl)cyclopentyl]-2,2-difluoroacetamide |
| SMILES | O=C(CCl)CC1(NC(=O)C(F)F)CCCC1 |
| InChI | InChI=1S/C10H14ClF2NO2/c11-6-7(15)5-10(3-1-2-4-10)14-9(16)8(12)13/h8H,1-6H2,(H,14,16) |
| InChIKey | YAMGTDBHOSOFGH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|