C8H11F2NO — CID 103517029
1,1-difluoro-3-(furan-2-yl)-N-methylpropan-2-amine (PubChem CID 103517029) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is 1,1-difluoro-3-(furan-2-yl)-N-methylpropan-2-amine.
| Compound Name | 1,1-difluoro-3-(furan-2-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 103517029 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 1,1-difluoro-3-(furan-2-yl)-N-methylpropan-2-amine |
| SMILES | CNC(Cc1ccco1)C(F)F |
| InChI | InChI=1S/C8H11F2NO/c1-11-7(8(9)10)5-6-3-2-4-12-6/h2-4,7-8,11H,5H2,1H3 |
| InChIKey | KIYCOILIJSCCST-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |