C11H20N2O — CID 83182874
4-(furan-2-yl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine (PubChem CID 83182874) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-(furan-2-yl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine.
| Compound Name | 4-(furan-2-yl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 83182874 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-(furan-2-yl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine |
| SMILES | CNC(CCN(C)C)Cc1ccco1 |
| InChI | InChI=1S/C11H20N2O/c1-12-10(6-7-13(2)3)9-11-5-4-8-14-11/h4-5,8,10,12H,6-7,9H2,1-3H3 |
| InChIKey | ONKSKGBIGMYOAE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |