C14H25NO — CID 105029568
1-(furan-2-yl)-N,4,5,5-tetramethylhexan-2-amine (PubChem CID 105029568) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-(furan-2-yl)-N,4,5,5-tetramethylhexan-2-amine.
| Compound Name | 1-(furan-2-yl)-N,4,5,5-tetramethylhexan-2-amine |
|---|---|
| PubChem CID | 105029568 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-(furan-2-yl)-N,4,5,5-tetramethylhexan-2-amine |
| SMILES | CNC(Cc1ccco1)CC(C)C(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-11(14(2,3)4)9-12(15-5)10-13-7-6-8-16-13/h6-8,11-12,15H,9-10H2,1-5H3 |
| InChIKey | UMMMCDYCCFJIQQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |