C16H25BrFN — CID 105020658
1-(2-bromo-3-fluorophenyl)-N,4,5,5-tetramethylhexan-2-amine (PubChem CID 105020658) has the molecular formula C16H25BrFN and a molecular weight of 330.29 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-N,4,5,5-tetramethylhexan-2-amine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-N,4,5,5-tetramethylhexan-2-amine |
|---|---|
| PubChem CID | 105020658 |
| Molecular Formula | C16H25BrFN |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-N,4,5,5-tetramethylhexan-2-amine |
| SMILES | CNC(Cc1cccc(F)c1Br)CC(C)C(C)(C)C |
| InChI | InChI=1S/C16H25BrFN/c1-11(16(2,3)4)9-13(19-5)10-12-7-6-8-14(18)15(12)17/h6-8,11,13,19H,9-10H2,1-5H3 |
| InChIKey | KTLQFQAYUQGEFL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |