C18H21BrFN — CID 105172022
1-(2-bromo-3-fluorophenyl)-N-methyl-5-phenylpentan-2-amine (PubChem CID 105172022) has the molecular formula C18H21BrFN and a molecular weight of 350.27 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-N-methyl-5-phenylpentan-2-amine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-N-methyl-5-phenylpentan-2-amine |
|---|---|
| PubChem CID | 105172022 |
| Molecular Formula | C18H21BrFN |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-N-methyl-5-phenylpentan-2-amine |
| SMILES | CNC(CCCc1ccccc1)Cc1cccc(F)c1Br |
| InChI | InChI=1S/C18H21BrFN/c1-21-16(11-5-9-14-7-3-2-4-8-14)13-15-10-6-12-17(20)18(15)19/h2-4,6-8,10,12,16,21H,5,9,11,13H2,1H3 |
| InChIKey | MGYBRZGIFCUQTA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |