C13H21BrN2 — CID 115346323
4-(4-bromophenyl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine (PubChem CID 115346323) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine.
| Compound Name | 4-(4-bromophenyl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115346323 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-(4-bromophenyl)-1-N,1-N,3-N-trimethylbutane-1,3-diamine |
| SMILES | CNC(CCN(C)C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H21BrN2/c1-15-13(8-9-16(2)3)10-11-4-6-12(14)7-5-11/h4-7,13,15H,8-10H2,1-3H3 |
| InChIKey | DPHIPPAMNKIFCE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |