C12H16BrN — CID 61380777
1-(4-bromophenyl)-N-methylpent-4-en-2-amine (PubChem CID 61380777) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-methylpent-4-en-2-amine.
| Compound Name | 1-(4-bromophenyl)-N-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 61380777 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-(4-bromophenyl)-N-methylpent-4-en-2-amine |
| SMILES | C=CCC(Cc1ccc(Br)cc1)NC |
| InChI | InChI=1S/C12H16BrN/c1-3-4-12(14-2)9-10-5-7-11(13)8-6-10/h3,5-8,12,14H,1,4,9H2,2H3 |
| InChIKey | PVWBGDBOBWMSAK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|