C8H13F2N3 — CID 103517203
1,1-difluoro-4-(1-methylimidazol-2-yl)butan-2-amine (PubChem CID 103517203) has the molecular formula C8H13F2N3 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1,1-difluoro-4-(1-methylimidazol-2-yl)butan-2-amine.
| Compound Name | 1,1-difluoro-4-(1-methylimidazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 103517203 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 1,1-difluoro-4-(1-methylimidazol-2-yl)butan-2-amine |
| SMILES | Cn1ccnc1CCC(N)C(F)F |
| InChI | InChI=1S/C8H13F2N3/c1-13-5-4-12-7(13)3-2-6(11)8(9)10/h4-6,8H,2-3,11H2,1H3 |
| InChIKey | UGCIQAYKMCYIJR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |