C8H12O3 — CID 10351910
(E)-4-(2-methyl-1,3-dioxolan-2-yl)but-2-enal (PubChem CID 10351910) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (E)-4-(2-methyl-1,3-dioxolan-2-yl)but-2-enal.
| Compound Name | (E)-4-(2-methyl-1,3-dioxolan-2-yl)but-2-enal |
|---|---|
| PubChem CID | 10351910 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (E)-4-(2-methyl-1,3-dioxolan-2-yl)but-2-enal |
| SMILES | CC1(C/C=C/C=O)OCCO1 |
| InChI | InChI=1S/C8H12O3/c1-8(4-2-3-5-9)10-6-7-11-8/h2-3,5H,4,6-7H2,1H3/b3-2+ |
| InChIKey | BPKYMJPHQUGBSD-NSCUHMNNSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|