C14H31N3O2S — CID 103520779
2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]butan-1-amine (PubChem CID 103520779) has the molecular formula C14H31N3O2S and a molecular weight of 305.49 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]butan-1-amine.
| Compound Name | 2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 103520779 |
| Molecular Formula | C14H31N3O2S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]butan-1-amine |
| SMILES | CCC(CN)N1CCN(S(=O)(=O)CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H31N3O2S/c1-5-13(12-15)16-7-9-17(10-8-16)20(18,19)11-6-14(2,3)4/h13H,5-12,15H2,1-4H3 |
| InChIKey | VMFSCUVXFBRNMI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |