C15H29N3O2S — CID 103521141
2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]pentanenitrile (PubChem CID 103521141) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]pentanenitrile.
| Compound Name | 2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 103521141 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-[4-(3,3-dimethylbutylsulfonyl)piperazin-1-yl]pentanenitrile |
| SMILES | CCCC(C#N)N1CCN(S(=O)(=O)CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29N3O2S/c1-5-6-14(13-16)17-8-10-18(11-9-17)21(19,20)12-7-15(2,3)4/h14H,5-12H2,1-4H3 |
| InChIKey | GTTVSQDYHVBDCR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |