C14H21NO4S2 — CID 103521687
(E)-3-[5-[(3,3-dimethylbutylsulfonylamino)methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 103521687) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (E)-3-[5-[(3,3-dimethylbutylsulfonylamino)methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(3,3-dimethylbutylsulfonylamino)methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103521687 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (E)-3-[5-[(3,3-dimethylbutylsulfonylamino)methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)CCS(=O)(=O)NCc1ccc(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C14H21NO4S2/c1-14(2,3)8-9-21(18,19)15-10-12-5-4-11(20-12)6-7-13(16)17/h4-7,15H,8-10H2,1-3H3,(H,16,17)/b7-6+ |
| InChIKey | VELMSVXQRBTSOE-VOTSOKGWSA-N |
| XLogP | 2.70 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|