C11H22BrNO2S — CID 103521784
N-(2-bromo-2-cyclopropylethyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521784) has the molecular formula C11H22BrNO2S and a molecular weight of 312.27 g/mol. Its IUPAC name is N-(2-bromo-2-cyclopropylethyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(2-bromo-2-cyclopropylethyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521784 |
| Molecular Formula | C11H22BrNO2S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(2-bromo-2-cyclopropylethyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCC(Br)C1CC1 |
| InChI | InChI=1S/C11H22BrNO2S/c1-11(2,3)6-7-16(14,15)13-8-10(12)9-4-5-9/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | PEGGXLDLKOAQLA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|