C11H24BrNO2S — CID 103521842
N-(3-bromopentyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521842) has the molecular formula C11H24BrNO2S and a molecular weight of 314.29 g/mol. Its IUPAC name is N-(3-bromopentyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(3-bromopentyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521842 |
| Molecular Formula | C11H24BrNO2S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(3-bromopentyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CCC(Br)CCNS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H24BrNO2S/c1-5-10(12)6-8-13-16(14,15)9-7-11(2,3)4/h10,13H,5-9H2,1-4H3 |
| InChIKey | TXPRSJFGNVHZLR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|