C14H18INO2 — CID 103522096
(2,4-dimethylpiperidin-1-yl)-(2-hydroxy-5-iodophenyl)methanone (PubChem CID 103522096) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is (2,4-dimethylpiperidin-1-yl)-(2-hydroxy-5-iodophenyl)methanone.
| Compound Name | (2,4-dimethylpiperidin-1-yl)-(2-hydroxy-5-iodophenyl)methanone |
|---|---|
| PubChem CID | 103522096 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2,4-dimethylpiperidin-1-yl)-(2-hydroxy-5-iodophenyl)methanone |
| SMILES | CC1CCN(C(=O)c2cc(I)ccc2O)C(C)C1 |
| InChI | InChI=1S/C14H18INO2/c1-9-5-6-16(10(2)7-9)14(18)12-8-11(15)3-4-13(12)17/h3-4,8-10,17H,5-7H2,1-2H3 |
| InChIKey | GFNZGTXBWAMCJW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|