C12H16BrF2NO — CID 103522473
3-[1-(4-bromophenyl)propan-2-ylamino]-2,2-difluoropropan-1-ol (PubChem CID 103522473) has the molecular formula C12H16BrF2NO and a molecular weight of 308.17 g/mol. Its IUPAC name is 3-[1-(4-bromophenyl)propan-2-ylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[1-(4-bromophenyl)propan-2-ylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 103522473 |
| Molecular Formula | C12H16BrF2NO |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-[1-(4-bromophenyl)propan-2-ylamino]-2,2-difluoropropan-1-ol |
| SMILES | CC(Cc1ccc(Br)cc1)NCC(F)(F)CO |
| InChI | InChI=1S/C12H16BrF2NO/c1-9(16-7-12(14,15)8-17)6-10-2-4-11(13)5-3-10/h2-5,9,16-17H,6-8H2,1H3 |
| InChIKey | JCTQDIPXMARLAM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |