C12H17F3N2O — CID 166473268
3-[[(2R)-1-(3-amino-2-fluorophenyl)propan-2-yl]amino]-2,2-difluoropropan-1-ol (PubChem CID 166473268) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-[[(2R)-1-(3-amino-2-fluorophenyl)propan-2-yl]amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[[(2R)-1-(3-amino-2-fluorophenyl)propan-2-yl]amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 166473268 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[[(2R)-1-(3-amino-2-fluorophenyl)propan-2-yl]amino]-2,2-difluoropropan-1-ol |
| SMILES | C[C@H](Cc1cccc(N)c1F)NCC(F)(F)CO |
| InChI | InChI=1S/C12H17F3N2O/c1-8(17-6-12(14,15)7-18)5-9-3-2-4-10(16)11(9)13/h2-4,8,17-18H,5-7,16H2,1H3/t8-/m1/s1 |
| InChIKey | XGIDCINGNRTIEQ-MRVPVSSYSA-N |
| XLogP | 1.56 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|