C16H24BrNO2 — CID 103523023
1-(3-bromo-2,4-dimethoxyphenyl)-3,4-dimethylcyclohexan-1-amine (PubChem CID 103523023) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-3,4-dimethylcyclohexan-1-amine.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-3,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 103523023 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-3,4-dimethylcyclohexan-1-amine |
| SMILES | COc1ccc(C2(N)CCC(C)C(C)C2)c(OC)c1Br |
| InChI | InChI=1S/C16H24BrNO2/c1-10-7-8-16(18,9-11(10)2)12-5-6-13(19-3)14(17)15(12)20-4/h5-6,10-11H,7-9,18H2,1-4H3 |
| InChIKey | KXLBZVGHKYTXOX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |