C17H25BrO3 — CID 103522872
1-(3-bromo-2,4-dimethoxyphenyl)-4,4-dimethylcycloheptan-1-ol (PubChem CID 103522872) has the molecular formula C17H25BrO3 and a molecular weight of 357.29 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethoxyphenyl)-4,4-dimethylcycloheptan-1-ol.
| Compound Name | 1-(3-bromo-2,4-dimethoxyphenyl)-4,4-dimethylcycloheptan-1-ol |
|---|---|
| PubChem CID | 103522872 |
| Molecular Formula | C17H25BrO3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-(3-bromo-2,4-dimethoxyphenyl)-4,4-dimethylcycloheptan-1-ol |
| SMILES | COc1ccc(C2(O)CCCC(C)(C)CC2)c(OC)c1Br |
| InChI | InChI=1S/C17H25BrO3/c1-16(2)8-5-9-17(19,11-10-16)12-6-7-13(20-3)14(18)15(12)21-4/h6-7,19H,5,8-11H2,1-4H3 |
| InChIKey | XOWIZJLWVIWGEE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |