C14H14BrClN2O2 — CID 103523606
(3-bromo-2,4-dimethoxyphenyl)-(3-chloro-2-pyridinyl)methanamine (PubChem CID 103523606) has the molecular formula C14H14BrClN2O2 and a molecular weight of 357.64 g/mol. Its IUPAC name is (3-bromo-2,4-dimethoxyphenyl)-(3-chloro-2-pyridinyl)methanamine.
| Compound Name | (3-bromo-2,4-dimethoxyphenyl)-(3-chloro-2-pyridinyl)methanamine |
|---|---|
| PubChem CID | 103523606 |
| Molecular Formula | C14H14BrClN2O2 |
| Molecular Weight | 357.64 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | (3-bromo-2,4-dimethoxyphenyl)-(3-chloro-2-pyridinyl)methanamine |
| SMILES | COc1ccc(C(N)c2ncccc2Cl)c(OC)c1Br |
| InChI | InChI=1S/C14H14BrClN2O2/c1-19-10-6-5-8(14(20-2)11(10)15)12(17)13-9(16)4-3-7-18-13/h3-7,12H,17H2,1-2H3 |
| InChIKey | VNPAVZABFSPARY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |