C15H18BrN3O2 — CID 103524053
6-(3-bromo-2,4-dimethoxyphenyl)-N,2,5-trimethylpyrimidin-4-amine (PubChem CID 103524053) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is 6-(3-bromo-2,4-dimethoxyphenyl)-N,2,5-trimethylpyrimidin-4-amine.
| Compound Name | 6-(3-bromo-2,4-dimethoxyphenyl)-N,2,5-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103524053 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 6-(3-bromo-2,4-dimethoxyphenyl)-N,2,5-trimethylpyrimidin-4-amine |
| SMILES | CNc1nc(C)nc(-c2ccc(OC)c(Br)c2OC)c1C |
| InChI | InChI=1S/C15H18BrN3O2/c1-8-13(18-9(2)19-15(8)17-3)10-6-7-11(20-4)12(16)14(10)21-5/h6-7H,1-5H3,(H,17,18,19) |
| InChIKey | VUGGGRQKPIISIR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |