C13H10BrClN2O4 — CID 103523989
2-(3-bromo-2,4-dimethoxyphenyl)-6-chloro-3-nitropyridine (PubChem CID 103523989) has the molecular formula C13H10BrClN2O4 and a molecular weight of 373.59 g/mol. Its IUPAC name is 2-(3-bromo-2,4-dimethoxyphenyl)-6-chloro-3-nitropyridine.
| Compound Name | 2-(3-bromo-2,4-dimethoxyphenyl)-6-chloro-3-nitropyridine |
|---|---|
| PubChem CID | 103523989 |
| Molecular Formula | C13H10BrClN2O4 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 2-(3-bromo-2,4-dimethoxyphenyl)-6-chloro-3-nitropyridine |
| SMILES | COc1ccc(-c2nc(Cl)ccc2[N+](=O)[O-])c(OC)c1Br |
| InChI | InChI=1S/C13H10BrClN2O4/c1-20-9-5-3-7(13(21-2)11(9)14)12-8(17(18)19)4-6-10(15)16-12/h3-6H,1-2H3 |
| InChIKey | UMMQPSKKCWYEAN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|