C13H10BrClN2O3 — CID 103523979
4-(3-bromo-2,4-dimethoxyphenyl)-6-chloropyrimidine-5-carbaldehyde (PubChem CID 103523979) has the molecular formula C13H10BrClN2O3 and a molecular weight of 357.59 g/mol. Its IUPAC name is 4-(3-bromo-2,4-dimethoxyphenyl)-6-chloropyrimidine-5-carbaldehyde.
| Compound Name | 4-(3-bromo-2,4-dimethoxyphenyl)-6-chloropyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 103523979 |
| Molecular Formula | C13H10BrClN2O3 |
| Molecular Weight | 357.59 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 4-(3-bromo-2,4-dimethoxyphenyl)-6-chloropyrimidine-5-carbaldehyde |
| SMILES | COc1ccc(-c2ncnc(Cl)c2C=O)c(OC)c1Br |
| InChI | InChI=1S/C13H10BrClN2O3/c1-19-9-4-3-7(12(20-2)10(9)14)11-8(5-18)13(15)17-6-16-11/h3-6H,1-2H3 |
| InChIKey | XCAFPFYHSMLGNX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|