C14H12BrNO3 — CID 103523707
5-(3-bromo-2,4-dimethoxyphenyl)pyridine-3-carbaldehyde (PubChem CID 103523707) has the molecular formula C14H12BrNO3 and a molecular weight of 322.16 g/mol. Its IUPAC name is 5-(3-bromo-2,4-dimethoxyphenyl)pyridine-3-carbaldehyde.
| Compound Name | 5-(3-bromo-2,4-dimethoxyphenyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 103523707 |
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-(3-bromo-2,4-dimethoxyphenyl)pyridine-3-carbaldehyde |
| SMILES | COc1ccc(-c2cncc(C=O)c2)c(OC)c1Br |
| InChI | InChI=1S/C14H12BrNO3/c1-18-12-4-3-11(14(19-2)13(12)15)10-5-9(8-17)6-16-7-10/h3-8H,1-2H3 |
| InChIKey | VEQFUFOSFFLNSO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|