C14H14BrNO3 — CID 103524193
5-(3-bromo-2,4-dimethoxyphenyl)-3-methyl-1H-pyridin-2-one (PubChem CID 103524193) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-(3-bromo-2,4-dimethoxyphenyl)-3-methyl-1H-pyridin-2-one.
| Compound Name | 5-(3-bromo-2,4-dimethoxyphenyl)-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 103524193 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 5-(3-bromo-2,4-dimethoxyphenyl)-3-methyl-1H-pyridin-2-one |
| SMILES | COc1ccc(-c2c[nH]c(=O)c(C)c2)c(OC)c1Br |
| InChI | InChI=1S/C14H14BrNO3/c1-8-6-9(7-16-14(8)17)10-4-5-11(18-2)12(15)13(10)19-3/h4-7H,1-3H3,(H,16,17) |
| InChIKey | MPMJNUDHBNNIQJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |