C13H16BrNO3S — CID 103524357
(3-bromo-2,4-dimethoxyphenyl)-thiomorpholin-3-ylmethanone (PubChem CID 103524357) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is (3-bromo-2,4-dimethoxyphenyl)-thiomorpholin-3-ylmethanone.
| Compound Name | (3-bromo-2,4-dimethoxyphenyl)-thiomorpholin-3-ylmethanone |
|---|---|
| PubChem CID | 103524357 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (3-bromo-2,4-dimethoxyphenyl)-thiomorpholin-3-ylmethanone |
| SMILES | COc1ccc(C(=O)C2CSCCN2)c(OC)c1Br |
| InChI | InChI=1S/C13H16BrNO3S/c1-17-10-4-3-8(13(18-2)11(10)14)12(16)9-7-19-6-5-15-9/h3-4,9,15H,5-7H2,1-2H3 |
| InChIKey | ZDKAEBFDJJFJOI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |