C9H15F3N2O — CID 103528167
N-(3-methylbut-2-enyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 103528167) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(3-methylbut-2-enyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 103528167 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-(3-methylbut-2-enyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CC(C)=CCNC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c1-7(2)3-4-14-8(15)5-13-6-9(10,11)12/h3,13H,4-6H2,1-2H3,(H,14,15) |
| InChIKey | AHEUOGAXLWIYJM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|