C13H14F5N — CID 103529409
3-(4-fluorophenyl)-N-(2,2,3,3-tetrafluoropropyl)cyclobutan-1-amine (PubChem CID 103529409) has the molecular formula C13H14F5N and a molecular weight of 279.25 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(2,2,3,3-tetrafluoropropyl)cyclobutan-1-amine.
| Compound Name | 3-(4-fluorophenyl)-N-(2,2,3,3-tetrafluoropropyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 103529409 |
| Molecular Formula | C13H14F5N |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(2,2,3,3-tetrafluoropropyl)cyclobutan-1-amine |
| SMILES | Fc1ccc(C2CC(NCC(F)(F)C(F)F)C2)cc1 |
| InChI | InChI=1S/C13H14F5N/c14-10-3-1-8(2-4-10)9-5-11(6-9)19-7-13(17,18)12(15)16/h1-4,9,11-12,19H,5-7H2 |
| InChIKey | UDPVQKUYIMZGRN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|