C16H24FN — CID 64568470
N-(2,3-dimethylbutyl)-3-(4-fluorophenyl)cyclobutan-1-amine (PubChem CID 64568470) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-3-(4-fluorophenyl)cyclobutan-1-amine.
| Compound Name | N-(2,3-dimethylbutyl)-3-(4-fluorophenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 64568470 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | N-(2,3-dimethylbutyl)-3-(4-fluorophenyl)cyclobutan-1-amine |
| SMILES | CC(C)C(C)CNC1CC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FN/c1-11(2)12(3)10-18-16-8-14(9-16)13-4-6-15(17)7-5-13/h4-7,11-12,14,16,18H,8-10H2,1-3H3 |
| InChIKey | VTQFRCRZZIKIPW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |