C10H13F4NS — CID 103529513
N-[(5-ethylthiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529513) has the molecular formula C10H13F4NS and a molecular weight of 255.28 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529513 |
| Molecular Formula | C10H13F4NS |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCc1ccc(CNCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C10H13F4NS/c1-2-7-3-4-8(16-7)5-15-6-10(13,14)9(11)12/h3-4,9,15H,2,5-6H2,1H3 |
| InChIKey | JVCXUGYOWOTXKO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|