C12H20N2OS — CID 103530823
1-(3-methoxypyrrolidin-1-yl)-1-thiophen-3-ylpropan-2-amine (PubChem CID 103530823) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(3-methoxypyrrolidin-1-yl)-1-thiophen-3-ylpropan-2-amine.
| Compound Name | 1-(3-methoxypyrrolidin-1-yl)-1-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 103530823 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(3-methoxypyrrolidin-1-yl)-1-thiophen-3-ylpropan-2-amine |
| SMILES | COC1CCN(C(c2ccsc2)C(C)N)C1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(13)12(10-4-6-16-8-10)14-5-3-11(7-14)15-2/h4,6,8-9,11-12H,3,5,7,13H2,1-2H3 |
| InChIKey | GXVPWMKFWOQUPM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |