C12H17F3N2S — CID 114271769
1-thiophen-3-yl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine (PubChem CID 114271769) has the molecular formula C12H17F3N2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-thiophen-3-yl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine.
| Compound Name | 1-thiophen-3-yl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 114271769 |
| Molecular Formula | C12H17F3N2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-thiophen-3-yl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]propan-2-amine |
| SMILES | CC(N)C(c1ccsc1)N1CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H17F3N2S/c1-8(16)11(9-3-5-18-7-9)17-4-2-10(6-17)12(13,14)15/h3,5,7-8,10-11H,2,4,6,16H2,1H3 |
| InChIKey | NMPHMRYHHDLFRL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |