C12H24N2O2S — CID 103531803
[3-(3,4-dimethoxypyrrolidin-1-yl)thian-3-yl]methanamine (PubChem CID 103531803) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is [3-(3,4-dimethoxypyrrolidin-1-yl)thian-3-yl]methanamine.
| Compound Name | [3-(3,4-dimethoxypyrrolidin-1-yl)thian-3-yl]methanamine |
|---|---|
| PubChem CID | 103531803 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [3-(3,4-dimethoxypyrrolidin-1-yl)thian-3-yl]methanamine |
| SMILES | COC1CN(C2(CN)CCCSC2)CC1OC |
| InChI | InChI=1S/C12H24N2O2S/c1-15-10-6-14(7-11(10)16-2)12(8-13)4-3-5-17-9-12/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | LQUMTUFBPOMNAN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |