C13H27N3S — CID 114086499
[3-(2,4-dimethyl-1,4-diazepan-1-yl)thian-3-yl]methanamine (PubChem CID 114086499) has the molecular formula C13H27N3S and a molecular weight of 257.45 g/mol. Its IUPAC name is [3-(2,4-dimethyl-1,4-diazepan-1-yl)thian-3-yl]methanamine.
| Compound Name | [3-(2,4-dimethyl-1,4-diazepan-1-yl)thian-3-yl]methanamine |
|---|---|
| PubChem CID | 114086499 |
| Molecular Formula | C13H27N3S |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | [3-(2,4-dimethyl-1,4-diazepan-1-yl)thian-3-yl]methanamine |
| SMILES | CC1CN(C)CCCN1C1(CN)CCCSC1 |
| InChI | InChI=1S/C13H27N3S/c1-12-9-15(2)6-4-7-16(12)13(10-14)5-3-8-17-11-13/h12H,3-11,14H2,1-2H3 |
| InChIKey | BWPSMGUAETZHDM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |