About 2-bromoethyl dimethyl phosphite
2-bromoethyl dimethyl phosphite (PubChem CID 10353282) has the molecular formula C4H10BrO3P
and a molecular weight of 217.00 g/mol. Its IUPAC name is 2-bromoethyl dimethyl phosphite.
Molecular Properties
| Compound Name | 2-bromoethyl dimethyl phosphite |
| PubChem CID | 10353282 |
| Molecular Formula | C4H10BrO3P |
| Molecular Weight | 217.00 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 2-bromoethyl dimethyl phosphite |
| SMILES | COP(OC)OCCBr |
| InChI | InChI=1S/C4H10BrO3P/c1-6-9(7-2)8-4-3-5/h3-4H2,1-2H3 |
| InChIKey | FZTXGIUKIRPHID-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.00 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl dimethyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl dimethyl phosphite?
The IUPAC name of 2-bromoethyl dimethyl phosphite (CID 10353282) is 2-bromoethyl dimethyl phosphite.
What is the SMILES notation for 2-bromoethyl dimethyl phosphite?
The canonical SMILES for 2-bromoethyl dimethyl phosphite is COP(OC)OCCBr.
What is the InChIKey of 2-bromoethyl dimethyl phosphite?
The InChIKey is FZTXGIUKIRPHID-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10BrO3P/c1-6-9(7-2)8-4-3-5/h3-4H2,1-2H3.
What are the key properties of 2-bromoethyl dimethyl phosphite?
2-bromoethyl dimethyl phosphite has a molecular weight of 217.00 g/mol, XLogP of 1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl dimethyl phosphite is sourced from PubChem (CID 10353282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).