C9H16F3N3O — CID 103534168
3,3,3-trifluoro-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide (PubChem CID 103534168) has the molecular formula C9H16F3N3O and a molecular weight of 239.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103534168 |
| Molecular Formula | C9H16F3N3O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-methoxypyrrolidin-1-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCC(OC)C1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O/c1-16-6-2-3-15(4-6)5-7(8(13)14)9(10,11)12/h6-7H,2-5H2,1H3,(H3,13,14) |
| InChIKey | PNRWTNDEICXJTP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|