C8H17N5O2 — CID 103534607
N-(diaminomethylidene)-3,4-dimethoxypyrrolidine-1-carboximidamide (PubChem CID 103534607) has the molecular formula C8H17N5O2 and a molecular weight of 215.26 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,4-dimethoxypyrrolidine-1-carboximidamide.
| Compound Name | N-(diaminomethylidene)-3,4-dimethoxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103534607 |
| Molecular Formula | C8H17N5O2 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-(diaminomethylidene)-3,4-dimethoxypyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C8H17N5O2/c1-14-5-3-13(4-6(5)15-2)8(11)12-7(9)10/h5-6H,3-4H2,1-2H3,(H5,9,10,11,12) |
| InChIKey | IDCMIVHBXKNNLK-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|