C13H26N2O2 — CID 14268559
N,3-dibutyl-5-(methoxymethyl)-1,3-oxazolidin-2-imine (PubChem CID 14268559) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N,3-dibutyl-5-(methoxymethyl)-1,3-oxazolidin-2-imine.
| Compound Name | N,3-dibutyl-5-(methoxymethyl)-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 14268559 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N,3-dibutyl-5-(methoxymethyl)-1,3-oxazolidin-2-imine |
| SMILES | CCCC/N=C1\OC(COC)CN1CCCC |
| InChI | InChI=1S/C13H26N2O2/c1-4-6-8-14-13-15(9-7-5-2)10-12(17-13)11-16-3/h12H,4-11H2,1-3H3/b14-13- |
| InChIKey | RYHMDLHIRBWAHS-YPKPFQOOSA-N |
| XLogP | 2.29 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|