C13H26N2O — CID 14868427
(4R,5S)-N,3-dibutyl-4,5-dimethyl-1,3-oxazolidin-2-imine (PubChem CID 14868427) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is (4R,5S)-N,3-dibutyl-4,5-dimethyl-1,3-oxazolidin-2-imine.
| Compound Name | (4R,5S)-N,3-dibutyl-4,5-dimethyl-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 14868427 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (4R,5S)-N,3-dibutyl-4,5-dimethyl-1,3-oxazolidin-2-imine |
| SMILES | CCCC/N=C1\O[C@@H](C)[C@@H](C)N1CCCC |
| InChI | InChI=1S/C13H26N2O/c1-5-7-9-14-13-15(10-8-6-2)11(3)12(4)16-13/h11-12H,5-10H2,1-4H3/b14-13-/t11-,12+/m1/s1 |
| InChIKey | YKJFKLVCMBPQSA-XWMVSFSJSA-N |
| XLogP | 3.05 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|