C8H16N2O — CID 91035109
3,4-dimethyl-N-propan-2-yl-1,3-oxazolidin-2-imine (PubChem CID 91035109) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 3,4-dimethyl-N-propan-2-yl-1,3-oxazolidin-2-imine.
| Compound Name | 3,4-dimethyl-N-propan-2-yl-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 91035109 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 3,4-dimethyl-N-propan-2-yl-1,3-oxazolidin-2-imine |
| SMILES | CC(C)/N=C1\OCC(C)N1C |
| InChI | InChI=1S/C8H16N2O/c1-6(2)9-8-10(4)7(3)5-11-8/h6-7H,5H2,1-4H3/b9-8- |
| InChIKey | OSMVRORLVHSQJY-HJWRWDBZSA-N |
| XLogP | 1.10 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|